C14H9F2NO — CID 62784850
3-[(3,5-difluorophenoxy)methyl]benzonitrile (PubChem CID 62784850) has the molecular formula C14H9F2NO and a molecular weight of 245.23 g/mol. Its IUPAC name is 3-[(3,5-difluorophenoxy)methyl]benzonitrile.
| Compound Name | 3-[(3,5-difluorophenoxy)methyl]benzonitrile |
|---|---|
| PubChem CID | 62784850 |
| Molecular Formula | C14H9F2NO |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-[(3,5-difluorophenoxy)methyl]benzonitrile |
| SMILES | N#Cc1cccc(COc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C14H9F2NO/c15-12-5-13(16)7-14(6-12)18-9-11-3-1-2-10(4-11)8-17/h1-7H,9H2 |
| InChIKey | BPPRGKOXDWTDRQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |