About (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate
(3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate (PubChem CID 41383660) has the molecular formula C16H12FNO3
and a molecular weight of 285.27 g/mol. Its IUPAC name is (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate.
Molecular Properties
| Compound Name | (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate |
| PubChem CID | 41383660 |
| Molecular Formula | C16H12FNO3 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate |
| SMILES | N#Cc1cccc(COC(=O)COc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H12FNO3/c17-14-4-6-15(7-5-14)20-11-16(19)21-10-13-3-1-2-12(8-13)9-18/h1-8H,10-11H2 |
| InChIKey | DHWDFZADAOKCJY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate?
The IUPAC name of (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate (CID 41383660) is (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate.
What is the SMILES notation for (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate?
The canonical SMILES for (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate is N#Cc1cccc(COC(=O)COc2ccc(F)cc2)c1.
What is the InChIKey of (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate?
The InChIKey is DHWDFZADAOKCJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FNO3/c17-14-4-6-15(7-5-14)20-11-16(19)21-10-13-3-1-2-12(8-13)9-18/h1-8H,10-11H2.
What are the key properties of (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate?
(3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate has a molecular weight of 285.27 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyanophenyl)methyl 2-(4-fluorophenoxy)acetate is sourced from PubChem (CID 41383660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).