About (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate
(4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate (PubChem CID 61321388) has the molecular formula C15H14FNO3
and a molecular weight of 275.28 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate |
| PubChem CID | 61321388 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate |
| SMILES | Nc1ccc(OCC(=O)OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H14FNO3/c16-12-3-1-11(2-4-12)9-20-15(18)10-19-14-7-5-13(17)6-8-14/h1-8H,9-10,17H2 |
| InChIKey | CWODCWLTDOXPFJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate?
The IUPAC name of (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate (CID 61321388) is (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate.
What is the SMILES notation for (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate?
The canonical SMILES for (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate is Nc1ccc(OCC(=O)OCc2ccc(F)cc2)cc1.
What is the InChIKey of (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate?
The InChIKey is CWODCWLTDOXPFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FNO3/c16-12-3-1-11(2-4-12)9-20-15(18)10-19-14-7-5-13(17)6-8-14/h1-8H,9-10,17H2.
What are the key properties of (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate?
(4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate has a molecular weight of 275.28 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl 2-(4-aminophenoxy)acetate is sourced from PubChem (CID 61321388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).