About (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate
(4-methylphenyl)methyl 2-(4-aminophenoxy)acetate (PubChem CID 61321197) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate.
Molecular Properties
| Compound Name | (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate |
| PubChem CID | 61321197 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate |
| SMILES | Cc1ccc(COC(=O)COc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-12-2-4-13(5-3-12)10-20-16(18)11-19-15-8-6-14(17)7-9-15/h2-9H,10-11,17H2,1H3 |
| InChIKey | FOINFLWFWZRZSM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate?
The IUPAC name of (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate (CID 61321197) is (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate.
What is the SMILES notation for (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate?
The canonical SMILES for (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate is Cc1ccc(COC(=O)COc2ccc(N)cc2)cc1.
What is the InChIKey of (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate?
The InChIKey is FOINFLWFWZRZSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c1-12-2-4-13(5-3-12)10-20-16(18)11-19-15-8-6-14(17)7-9-15/h2-9H,10-11,17H2,1H3.
What are the key properties of (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate?
(4-methylphenyl)methyl 2-(4-aminophenoxy)acetate has a molecular weight of 271.32 g/mol, XLogP of 2.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methyl 2-(4-aminophenoxy)acetate is sourced from PubChem (CID 61321197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).