About 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate
2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate (PubChem CID 106705737) has the molecular formula C11H12F3NO4
and a molecular weight of 279.21 g/mol. Its IUPAC name is 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate |
| PubChem CID | 106705737 |
| Molecular Formula | C11H12F3NO4 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate |
| SMILES | Nc1ccc(OCC(=O)OCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO4/c12-11(13,14)6-17-7-19-10(16)5-18-9-3-1-8(15)2-4-9/h1-4H,5-7,15H2 |
| InChIKey | QLYHQAUUJPCVOW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate?
The IUPAC name of 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate (CID 106705737) is 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate.
What is the SMILES notation for 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate?
The canonical SMILES for 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate is Nc1ccc(OCC(=O)OCOCC(F)(F)F)cc1.
What is the InChIKey of 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate?
The InChIKey is QLYHQAUUJPCVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO4/c12-11(13,14)6-17-7-19-10(16)5-18-9-3-1-8(15)2-4-9/h1-4H,5-7,15H2.
What are the key properties of 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate?
2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate has a molecular weight of 279.21 g/mol, XLogP of 1.73, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethoxymethyl 2-(4-aminophenoxy)acetate is sourced from PubChem (CID 106705737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).