C14H18N2O4 — CID 61489511
[2-[cyclopropyl(methyl)amino]-2-oxoethyl] 2-(4-aminophenoxy)acetate (PubChem CID 61489511) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [2-[cyclopropyl(methyl)amino]-2-oxoethyl] 2-(4-aminophenoxy)acetate.
| Compound Name | [2-[cyclopropyl(methyl)amino]-2-oxoethyl] 2-(4-aminophenoxy)acetate |
|---|---|
| PubChem CID | 61489511 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [2-[cyclopropyl(methyl)amino]-2-oxoethyl] 2-(4-aminophenoxy)acetate |
| SMILES | CN(C(=O)COC(=O)COc1ccc(N)cc1)C1CC1 |
| InChI | InChI=1S/C14H18N2O4/c1-16(11-4-5-11)13(17)8-20-14(18)9-19-12-6-2-10(15)3-7-12/h2-3,6-7,11H,4-5,8-9,15H2,1H3 |
| InChIKey | NFOIEYFNSLRCEX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|