C14H19NO2 — CID 60749452
N-cyclopropyl-2-(3,5-dimethylphenoxy)-N-methylacetamide (PubChem CID 60749452) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-cyclopropyl-2-(3,5-dimethylphenoxy)-N-methylacetamide.
| Compound Name | N-cyclopropyl-2-(3,5-dimethylphenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 60749452 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-cyclopropyl-2-(3,5-dimethylphenoxy)-N-methylacetamide |
| SMILES | Cc1cc(C)cc(OCC(=O)N(C)C2CC2)c1 |
| InChI | InChI=1S/C14H19NO2/c1-10-6-11(2)8-13(7-10)17-9-14(16)15(3)12-4-5-12/h6-8,12H,4-5,9H2,1-3H3 |
| InChIKey | BOVRWNYPTKRLHS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |