C16H20ClFN2O4 — CID 155254242
[4-[[2-(4-chloro-3-fluorophenoxy)acetyl]-methylamino]cyclohexyl]carbamic acid (PubChem CID 155254242) has the molecular formula C16H20ClFN2O4 and a molecular weight of 358.80 g/mol. Its IUPAC name is [4-[[2-(4-chloro-3-fluorophenoxy)acetyl]-methylamino]cyclohexyl]carbamic acid.
| Compound Name | [4-[[2-(4-chloro-3-fluorophenoxy)acetyl]-methylamino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 155254242 |
| Molecular Formula | C16H20ClFN2O4 |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [4-[[2-(4-chloro-3-fluorophenoxy)acetyl]-methylamino]cyclohexyl]carbamic acid |
| SMILES | CN(C(=O)COc1ccc(Cl)c(F)c1)C1CCC(NC(=O)O)CC1 |
| InChI | InChI=1S/C16H20ClFN2O4/c1-20(11-4-2-10(3-5-11)19-16(22)23)15(21)9-24-12-6-7-13(17)14(18)8-12/h6-8,10-11,19H,2-5,9H2,1H3,(H,22,23) |
| InChIKey | CIHGOPPDPUWGDC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |