C13H15ClN2O2S — CID 102724327
2-(4-carbamothioyl-3-chlorophenoxy)-N-cyclopropyl-N-methylacetamide (PubChem CID 102724327) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is 2-(4-carbamothioyl-3-chlorophenoxy)-N-cyclopropyl-N-methylacetamide.
| Compound Name | 2-(4-carbamothioyl-3-chlorophenoxy)-N-cyclopropyl-N-methylacetamide |
|---|---|
| PubChem CID | 102724327 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-(4-carbamothioyl-3-chlorophenoxy)-N-cyclopropyl-N-methylacetamide |
| SMILES | CN(C(=O)COc1ccc(C(N)=S)c(Cl)c1)C1CC1 |
| InChI | InChI=1S/C13H15ClN2O2S/c1-16(8-2-3-8)12(17)7-18-9-4-5-10(13(15)19)11(14)6-9/h4-6,8H,2-3,7H2,1H3,(H2,15,19) |
| InChIKey | SUZBZOIDMUCWFX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|