C16H17ClF4N2O4 — CID 156689163
[(4-aminocyclohexyl)-[2-(4-chloro-3-fluorophenoxy)acetyl]amino] 2,2,2-trifluoroacetate (PubChem CID 156689163) has the molecular formula C16H17ClF4N2O4 and a molecular weight of 412.77 g/mol. Its IUPAC name is [(4-aminocyclohexyl)-[2-(4-chloro-3-fluorophenoxy)acetyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [(4-aminocyclohexyl)-[2-(4-chloro-3-fluorophenoxy)acetyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 156689163 |
| Molecular Formula | C16H17ClF4N2O4 |
| Molecular Weight | 412.77 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | [(4-aminocyclohexyl)-[2-(4-chloro-3-fluorophenoxy)acetyl]amino] 2,2,2-trifluoroacetate |
| SMILES | NC1CCC(N(OC(=O)C(F)(F)F)C(=O)COc2ccc(Cl)c(F)c2)CC1 |
| InChI | InChI=1S/C16H17ClF4N2O4/c17-12-6-5-11(7-13(12)18)26-8-14(24)23(27-15(25)16(19,20)21)10-3-1-9(22)2-4-10/h5-7,9-10H,1-4,8,22H2 |
| InChIKey | BBYBPDMUUUBVRV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.77 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|