C15H19ClFN3O4 — CID 175222959
[1-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]piperidin-4-yl]methyl carbamate (PubChem CID 175222959) has the molecular formula C15H19ClFN3O4 and a molecular weight of 359.79 g/mol. Its IUPAC name is [1-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]piperidin-4-yl]methyl carbamate.
| Compound Name | [1-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]piperidin-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 175222959 |
| Molecular Formula | C15H19ClFN3O4 |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [1-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]piperidin-4-yl]methyl carbamate |
| SMILES | NC(=O)OCC1CCN(NC(=O)COc2ccc(Cl)c(F)c2)CC1 |
| InChI | InChI=1S/C15H19ClFN3O4/c16-12-2-1-11(7-13(12)17)23-9-14(21)19-20-5-3-10(4-6-20)8-24-15(18)22/h1-2,7,10H,3-6,8-9H2,(H2,18,22)(H,19,21) |
| InChIKey | SYVICOSFUAFJFL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |