C15H20ClFN2O4 — CID 175195941
[1-[3-(4-chloro-3-fluorophenoxy)-2-hydroxypropyl]pyrrolidin-3-yl]methyl carbamate (PubChem CID 175195941) has the molecular formula C15H20ClFN2O4 and a molecular weight of 346.79 g/mol. Its IUPAC name is [1-[3-(4-chloro-3-fluorophenoxy)-2-hydroxypropyl]pyrrolidin-3-yl]methyl carbamate.
| Compound Name | [1-[3-(4-chloro-3-fluorophenoxy)-2-hydroxypropyl]pyrrolidin-3-yl]methyl carbamate |
|---|---|
| PubChem CID | 175195941 |
| Molecular Formula | C15H20ClFN2O4 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [1-[3-(4-chloro-3-fluorophenoxy)-2-hydroxypropyl]pyrrolidin-3-yl]methyl carbamate |
| SMILES | NC(=O)OCC1CCN(CC(O)COc2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C15H20ClFN2O4/c16-13-2-1-12(5-14(13)17)22-9-11(20)7-19-4-3-10(6-19)8-23-15(18)21/h1-2,5,10-11,20H,3-4,6-9H2,(H2,18,21) |
| InChIKey | XMGMLMLNUACQBQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |