C19H21ClFNO3 — CID 141041922
1-[3-(4-chlorophenoxy)pyrrolidin-1-yl]-3-(4-fluorophenoxy)propan-2-ol (PubChem CID 141041922) has the molecular formula C19H21ClFNO3 and a molecular weight of 365.83 g/mol. Its IUPAC name is 1-[3-(4-chlorophenoxy)pyrrolidin-1-yl]-3-(4-fluorophenoxy)propan-2-ol.
| Compound Name | 1-[3-(4-chlorophenoxy)pyrrolidin-1-yl]-3-(4-fluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 141041922 |
| Molecular Formula | C19H21ClFNO3 |
| Molecular Weight | 365.83 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-[3-(4-chlorophenoxy)pyrrolidin-1-yl]-3-(4-fluorophenoxy)propan-2-ol |
| SMILES | OC(COc1ccc(F)cc1)CN1CCC(Oc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H21ClFNO3/c20-14-1-5-18(6-2-14)25-19-9-10-22(12-19)11-16(23)13-24-17-7-3-15(21)4-8-17/h1-8,16,19,23H,9-13H2 |
| InChIKey | YWCJMLHRGAKUDN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.83 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |