C21H25ClN2O4 — CID 154072204
2-[2-[(2R)-3-[(3S)-3-(4-chlorophenoxy)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide (PubChem CID 154072204) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 2-[2-[(2R)-3-[(3S)-3-(4-chlorophenoxy)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide.
| Compound Name | 2-[2-[(2R)-3-[(3S)-3-(4-chlorophenoxy)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 154072204 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-[2-[(2R)-3-[(3S)-3-(4-chlorophenoxy)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide |
| SMILES | NC(=O)Cc1ccccc1OC[C@H](O)CN1CC[C@H](Oc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H25ClN2O4/c22-16-5-7-18(8-6-16)28-19-9-10-24(13-19)12-17(25)14-27-20-4-2-1-3-15(20)11-21(23)26/h1-8,17,19,25H,9-14H2,(H2,23,26)/t17-,19+/m1/s1 |
| InChIKey | FSQPUQOASGDNAX-MJGOQNOKSA-N |
| XLogP | 2.26 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |