C20H24ClFN2O2 — CID 3859453
1-(4-chlorophenoxy)-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol (PubChem CID 3859453) has the molecular formula C20H24ClFN2O2 and a molecular weight of 378.88 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-(4-chlorophenoxy)-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 3859453 |
| Molecular Formula | C20H24ClFN2O2 |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol |
| SMILES | OC(COc1ccc(Cl)cc1)CN1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H24ClFN2O2/c21-17-3-7-20(8-4-17)26-15-19(25)14-24-11-9-23(10-12-24)13-16-1-5-18(22)6-2-16/h1-8,19,25H,9-15H2 |
| InChIKey | CYAWNGHXVUDFIE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |