C27H29ClN2O3 — CID 28822766
[4-[(2S)-3-(4-benzylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]-(4-chlorophenyl)methanone (PubChem CID 28822766) has the molecular formula C27H29ClN2O3 and a molecular weight of 464.99 g/mol. Its IUPAC name is [4-[(2S)-3-(4-benzylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]-(4-chlorophenyl)methanone.
| Compound Name | [4-[(2S)-3-(4-benzylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 28822766 |
| Molecular Formula | C27H29ClN2O3 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | [4-[(2S)-3-(4-benzylpiperazin-1-yl)-2-hydroxypropoxy]phenyl]-(4-chlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc(OC[C@@H](O)CN2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H29ClN2O3/c28-24-10-6-22(7-11-24)27(32)23-8-12-26(13-9-23)33-20-25(31)19-30-16-14-29(15-17-30)18-21-4-2-1-3-5-21/h1-13,25,31H,14-20H2/t25-/m0/s1 |
| InChIKey | DJFYBISBHODJNA-VWLOTQADSA-N |
| XLogP | 4.13 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |