C19H20Cl2FNO3 — CID 141041982
1-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]-3-(4-fluorophenoxy)propan-2-ol (PubChem CID 141041982) has the molecular formula C19H20Cl2FNO3 and a molecular weight of 400.28 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]-3-(4-fluorophenoxy)propan-2-ol.
| Compound Name | 1-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]-3-(4-fluorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 141041982 |
| Molecular Formula | C19H20Cl2FNO3 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 1-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]-3-(4-fluorophenoxy)propan-2-ol |
| SMILES | OC(COc1ccc(F)cc1)CN1CCC(Oc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C19H20Cl2FNO3/c20-18-6-5-16(9-19(18)21)26-17-7-8-23(11-17)10-14(24)12-25-15-3-1-13(22)2-4-15/h1-6,9,14,17,24H,7-8,10-12H2 |
| InChIKey | AKPPSWMEBCLCPZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |