C21H25Cl2NO3 — CID 141041950
1-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-3-(3-methylphenoxy)propan-2-ol (PubChem CID 141041950) has the molecular formula C21H25Cl2NO3 and a molecular weight of 410.34 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-3-(3-methylphenoxy)propan-2-ol.
| Compound Name | 1-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-3-(3-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 141041950 |
| Molecular Formula | C21H25Cl2NO3 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-3-(3-methylphenoxy)propan-2-ol |
| SMILES | Cc1cccc(OCC(O)CN2CCC(Oc3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C21H25Cl2NO3/c1-15-3-2-4-18(11-15)26-14-16(25)13-24-9-7-17(8-10-24)27-19-5-6-20(22)21(23)12-19/h2-6,11-12,16-17,25H,7-10,13-14H2,1H3 |
| InChIKey | LPNLIQCLDRIJFG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |