C22H26Cl2N2O3 — CID 129118190
(2S)-4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-1-(3-methanimidoylphenoxy)butan-2-ol (PubChem CID 129118190) has the molecular formula C22H26Cl2N2O3 and a molecular weight of 437.37 g/mol. Its IUPAC name is (2S)-4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-1-(3-methanimidoylphenoxy)butan-2-ol.
| Compound Name | (2S)-4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-1-(3-methanimidoylphenoxy)butan-2-ol |
|---|---|
| PubChem CID | 129118190 |
| Molecular Formula | C22H26Cl2N2O3 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (2S)-4-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-1-(3-methanimidoylphenoxy)butan-2-ol |
| SMILES | [H]/N=C/c1cccc(OC[C@@H](O)CCN2CCC(Oc3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C22H26Cl2N2O3/c23-21-5-4-20(13-22(21)24)29-18-7-10-26(11-8-18)9-6-17(27)15-28-19-3-1-2-16(12-19)14-25/h1-5,12-14,17-18,25,27H,6-11,15H2/b25-14+/t17-/m0/s1 |
| InChIKey | CMAWCNSTJKKXSU-YSGZUTGPSA-N |
| XLogP | 4.66 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|