C18H24Cl2N4O3 — CID 142274557
(E)-3-amino-N-[(2R)-3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-2-hydroxypropyl]-2-methanimidoylprop-2-enamide (PubChem CID 142274557) has the molecular formula C18H24Cl2N4O3 and a molecular weight of 415.32 g/mol. Its IUPAC name is (E)-3-amino-N-[(2R)-3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-2-hydroxypropyl]-2-methanimidoylprop-2-enamide.
| Compound Name | (E)-3-amino-N-[(2R)-3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-2-hydroxypropyl]-2-methanimidoylprop-2-enamide |
|---|---|
| PubChem CID | 142274557 |
| Molecular Formula | C18H24Cl2N4O3 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (E)-3-amino-N-[(2R)-3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]-2-hydroxypropyl]-2-methanimidoylprop-2-enamide |
| SMILES | [H]/N=C/C(=C\N)C(=O)NC[C@@H](O)CN1CCC(Oc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H24Cl2N4O3/c19-16-2-1-15(7-17(16)20)27-14-3-5-24(6-4-14)11-13(25)10-23-18(26)12(8-21)9-22/h1-2,7-9,13-14,21,25H,3-6,10-11,22H2,(H,23,26)/b12-9+,21-8+/t13-/m1/s1 |
| InChIKey | ZURHXQDUGJSBIP-OEGPDMKKSA-N |
| XLogP | 1.81 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|