C19H26Cl2N4O2 — CID 70849235
(E)-3-amino-N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-2-(methyliminomethyl)prop-2-enamide (PubChem CID 70849235) has the molecular formula C19H26Cl2N4O2 and a molecular weight of 413.35 g/mol. Its IUPAC name is (E)-3-amino-N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-2-(methyliminomethyl)prop-2-enamide.
| Compound Name | (E)-3-amino-N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-2-(methyliminomethyl)prop-2-enamide |
|---|---|
| PubChem CID | 70849235 |
| Molecular Formula | C19H26Cl2N4O2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (E)-3-amino-N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-2-(methyliminomethyl)prop-2-enamide |
| SMILES | C/N=C/C(=C\N)C(=O)NCCCN1CCC(Oc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H26Cl2N4O2/c1-23-13-14(12-22)19(26)24-7-2-8-25-9-5-15(6-10-25)27-16-3-4-17(20)18(21)11-16/h3-4,11-13,15H,2,5-10,22H2,1H3,(H,24,26)/b14-12+,23-13+ |
| InChIKey | VELJTMMKMVAKFW-GYROHWQESA-N |
| XLogP | 2.89 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|