C24H25Cl2N3O3S — CID 142274574
N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-1-oxo-7-sulfanyl-2H-isoquinoline-4-carboxamide (PubChem CID 142274574) has the molecular formula C24H25Cl2N3O3S and a molecular weight of 506.46 g/mol. Its IUPAC name is N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-1-oxo-7-sulfanyl-2H-isoquinoline-4-carboxamide.
| Compound Name | N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-1-oxo-7-sulfanyl-2H-isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 142274574 |
| Molecular Formula | C24H25Cl2N3O3S |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-1-oxo-7-sulfanyl-2H-isoquinoline-4-carboxamide |
| SMILES | O=C(NCCCN1CCC(Oc2ccc(Cl)c(Cl)c2)CC1)c1c[nH]c(=O)c2cc(S)ccc12 |
| InChI | InChI=1S/C24H25Cl2N3O3S/c25-21-5-2-16(12-22(21)26)32-15-6-10-29(11-7-15)9-1-8-27-24(31)20-14-28-23(30)19-13-17(33)3-4-18(19)20/h2-5,12-15,33H,1,6-11H2,(H,27,31)(H,28,30) |
| InChIKey | SVDMZVUXTLQAPO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|