C22H26Cl2N2O2 — CID 153458835
N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-3-methylbenzamide (PubChem CID 153458835) has the molecular formula C22H26Cl2N2O2 and a molecular weight of 421.37 g/mol. Its IUPAC name is N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-3-methylbenzamide.
| Compound Name | N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 153458835 |
| Molecular Formula | C22H26Cl2N2O2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCCCN2CCC(Oc3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C22H26Cl2N2O2/c1-16-4-2-5-17(14-16)22(27)25-10-3-11-26-12-8-18(9-13-26)28-19-6-7-20(23)21(24)15-19/h2,4-7,14-15,18H,3,8-13H2,1H3,(H,25,27) |
| InChIKey | HNANRCMFQYTSRA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|