C24H28Cl2N3O3- — CID 142274561
N-[2-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propylamino]-2-oxo-1-phenylethyl]ethanimidate (PubChem CID 142274561) has the molecular formula C24H28Cl2N3O3- and a molecular weight of 477.41 g/mol. Its IUPAC name is N-[2-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propylamino]-2-oxo-1-phenylethyl]ethanimidate.
| Compound Name | N-[2-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propylamino]-2-oxo-1-phenylethyl]ethanimidate |
|---|---|
| PubChem CID | 142274561 |
| Molecular Formula | C24H28Cl2N3O3- |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-[2-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propylamino]-2-oxo-1-phenylethyl]ethanimidate |
| SMILES | C/C([O-])=N\C(C(=O)NCCCN1CCC(Oc2ccc(Cl)c(Cl)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H29Cl2N3O3/c1-17(30)28-23(18-6-3-2-4-7-18)24(31)27-12-5-13-29-14-10-19(11-15-29)32-20-8-9-21(25)22(26)16-20/h2-4,6-9,16,19,23H,5,10-15H2,1H3,(H,27,31)(H,28,30)/p-1 |
| InChIKey | XYAMTYIUVKDOAS-UHFFFAOYSA-M |
| XLogP | 3.86 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|