C23H26Cl2N4O3 — CID 142274584
2-[2-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propylamino]-2-oxoethanimidoyl]benzamide (PubChem CID 142274584) has the molecular formula C23H26Cl2N4O3 and a molecular weight of 477.39 g/mol. Its IUPAC name is 2-[2-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propylamino]-2-oxoethanimidoyl]benzamide.
| Compound Name | 2-[2-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propylamino]-2-oxoethanimidoyl]benzamide |
|---|---|
| PubChem CID | 142274584 |
| Molecular Formula | C23H26Cl2N4O3 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-[2-[3-[4-(3,4-dichlorophenoxy)piperidin-1-yl]propylamino]-2-oxoethanimidoyl]benzamide |
| SMILES | [H]/N=C(\C(=O)NCCCN1CCC(Oc2ccc(Cl)c(Cl)c2)CC1)c1ccccc1C(N)=O |
| InChI | InChI=1S/C23H26Cl2N4O3/c24-19-7-6-16(14-20(19)25)32-15-8-12-29(13-9-15)11-3-10-28-23(31)21(26)17-4-1-2-5-18(17)22(27)30/h1-2,4-7,14-15,26H,3,8-13H2,(H2,27,30)(H,28,31)/b26-21- |
| InChIKey | ZJFCPPBXTMNIPS-QLYXXIJNSA-N |
| XLogP | 3.51 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|