C13H16Cl3NO3S — CID 87826645
2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethanesulfonyl chloride (PubChem CID 87826645) has the molecular formula C13H16Cl3NO3S and a molecular weight of 372.70 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethanesulfonyl chloride.
| Compound Name | 2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethanesulfonyl chloride |
|---|---|
| PubChem CID | 87826645 |
| Molecular Formula | C13H16Cl3NO3S |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)CCN1CCC(Oc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H16Cl3NO3S/c14-12-2-1-11(9-13(12)15)20-10-3-5-17(6-4-10)7-8-21(16,18)19/h1-2,9-10H,3-8H2 |
| InChIKey | ZWALUADROAGDPB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |