C21H25Cl2N3O2 — CID 10112968
4-(aminomethyl)-N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]benzamide (PubChem CID 10112968) has the molecular formula C21H25Cl2N3O2 and a molecular weight of 422.36 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]benzamide.
| Compound Name | 4-(aminomethyl)-N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 10112968 |
| Molecular Formula | C21H25Cl2N3O2 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 4-(aminomethyl)-N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]benzamide |
| SMILES | NCc1ccc(C(=O)NCCN2CCC(Oc3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C21H25Cl2N3O2/c22-19-6-5-18(13-20(19)23)28-17-7-10-26(11-8-17)12-9-25-21(27)16-3-1-15(14-24)2-4-16/h1-6,13,17H,7-12,14,24H2,(H,25,27) |
| InChIKey | PIOPNYHIIBJDKK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |