C20H23Cl2N3O2S — CID 10138131
N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]-2-(2-sulfanylidene-1H-pyridin-3-yl)acetamide (PubChem CID 10138131) has the molecular formula C20H23Cl2N3O2S and a molecular weight of 440.40 g/mol. Its IUPAC name is N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]-2-(2-sulfanylidene-1H-pyridin-3-yl)acetamide.
| Compound Name | N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]-2-(2-sulfanylidene-1H-pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 10138131 |
| Molecular Formula | C20H23Cl2N3O2S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]-2-(2-sulfanylidene-1H-pyridin-3-yl)acetamide |
| SMILES | O=C(Cc1ccc[nH]c1=S)NCCN1CCC(Oc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H23Cl2N3O2S/c21-17-4-3-16(13-18(17)22)27-15-5-9-25(10-6-15)11-8-23-19(26)12-14-2-1-7-24-20(14)28/h1-4,7,13,15H,5-6,8-12H2,(H,23,26)(H,24,28) |
| InChIKey | JMQNEKFFXKLDSA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|