C22H27Cl2N3O3 — CID 10161188
3-(2-aminoethoxy)-N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]benzamide (PubChem CID 10161188) has the molecular formula C22H27Cl2N3O3 and a molecular weight of 452.38 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]benzamide.
| Compound Name | 3-(2-aminoethoxy)-N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 10161188 |
| Molecular Formula | C22H27Cl2N3O3 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 3-(2-aminoethoxy)-N-[2-[4-(3,4-dichlorophenoxy)piperidin-1-yl]ethyl]benzamide |
| SMILES | NCCOc1cccc(C(=O)NCCN2CCC(Oc3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C22H27Cl2N3O3/c23-20-5-4-19(15-21(20)24)30-17-6-10-27(11-7-17)12-9-26-22(28)16-2-1-3-18(14-16)29-13-8-25/h1-5,14-15,17H,6-13,25H2,(H,26,28) |
| InChIKey | NPWHVGCYOALPRS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |