C23H28Cl4N2O3 — CID 138517946
(2S)-1-(3,4-dichlorophenoxy)-3-[4-[3-(3,4-dichlorophenoxy)propylamino]piperidin-1-yl]propan-2-ol (PubChem CID 138517946) has the molecular formula C23H28Cl4N2O3 and a molecular weight of 522.30 g/mol. Its IUPAC name is (2S)-1-(3,4-dichlorophenoxy)-3-[4-[3-(3,4-dichlorophenoxy)propylamino]piperidin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-(3,4-dichlorophenoxy)-3-[4-[3-(3,4-dichlorophenoxy)propylamino]piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 138517946 |
| Molecular Formula | C23H28Cl4N2O3 |
| Molecular Weight | 522.30 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | (2S)-1-(3,4-dichlorophenoxy)-3-[4-[3-(3,4-dichlorophenoxy)propylamino]piperidin-1-yl]propan-2-ol |
| SMILES | O[C@H](COc1ccc(Cl)c(Cl)c1)CN1CCC(NCCCOc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C23H28Cl4N2O3/c24-20-4-2-18(12-22(20)26)31-11-1-8-28-16-6-9-29(10-7-16)14-17(30)15-32-19-3-5-21(25)23(27)13-19/h2-5,12-13,16-17,28,30H,1,6-11,14-15H2/t17-/m0/s1 |
| InChIKey | HIXQGKVICMGUFA-KRWDZBQOSA-N |
| XLogP | 5.56 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.30 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|