C14H22N2O2 — CID 3095128
1-(3-methylphenoxy)-3-piperazin-1-ylpropan-2-ol (PubChem CID 3095128) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(3-methylphenoxy)-3-piperazin-1-ylpropan-2-ol.
| Compound Name | 1-(3-methylphenoxy)-3-piperazin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 3095128 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-(3-methylphenoxy)-3-piperazin-1-ylpropan-2-ol |
| SMILES | Cc1cccc(OCC(O)CN2CCNCC2)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-12-3-2-4-14(9-12)18-11-13(17)10-16-7-5-15-6-8-16/h2-4,9,13,15,17H,5-8,10-11H2,1H3 |
| InChIKey | BVNOFCQWFWCWSL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |