C16H26N2O2 — CID 95067042
(2R)-1-(1,4-diazepan-1-yl)-3-(3,5-dimethylphenoxy)propan-2-ol (PubChem CID 95067042) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (2R)-1-(1,4-diazepan-1-yl)-3-(3,5-dimethylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-(1,4-diazepan-1-yl)-3-(3,5-dimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 95067042 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (2R)-1-(1,4-diazepan-1-yl)-3-(3,5-dimethylphenoxy)propan-2-ol |
| SMILES | Cc1cc(C)cc(OC[C@H](O)CN2CCCNCC2)c1 |
| InChI | InChI=1S/C16H26N2O2/c1-13-8-14(2)10-16(9-13)20-12-15(19)11-18-6-3-4-17-5-7-18/h8-10,15,17,19H,3-7,11-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | HZIDOLGWYQMWHZ-OAHLLOKOSA-N |
| XLogP | 1.34 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |