C18H30N2O2 — CID 110887833
1-(3,5-dimethylphenoxy)-3-(4-propan-2-ylpiperazin-1-yl)propan-2-ol (PubChem CID 110887833) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-(3,5-dimethylphenoxy)-3-(4-propan-2-ylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-(3,5-dimethylphenoxy)-3-(4-propan-2-ylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 110887833 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 1-(3,5-dimethylphenoxy)-3-(4-propan-2-ylpiperazin-1-yl)propan-2-ol |
| SMILES | Cc1cc(C)cc(OCC(O)CN2CCN(C(C)C)CC2)c1 |
| InChI | InChI=1S/C18H30N2O2/c1-14(2)20-7-5-19(6-8-20)12-17(21)13-22-18-10-15(3)9-16(4)11-18/h9-11,14,17,21H,5-8,12-13H2,1-4H3 |
| InChIKey | JZOWRZLNMTUIRU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |