C23H32N2O3 — CID 97003615
(2S)-1-(3,5-dimethylphenoxy)-3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]propan-2-ol (PubChem CID 97003615) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is (2S)-1-(3,5-dimethylphenoxy)-3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]propan-2-ol.
| Compound Name | (2S)-1-(3,5-dimethylphenoxy)-3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 97003615 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (2S)-1-(3,5-dimethylphenoxy)-3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]propan-2-ol |
| SMILES | COc1ccc(N2CCCN(C[C@H](O)COc3cc(C)cc(C)c3)CC2)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-18-13-19(2)15-23(14-18)28-17-21(26)16-24-9-4-10-25(12-11-24)20-5-7-22(27-3)8-6-20/h5-8,13-15,21,26H,4,9-12,16-17H2,1-3H3/t21-/m0/s1 |
| InChIKey | NOZKQOIPJFVTCX-NRFANRHFSA-N |
| XLogP | 3.26 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|