C24H32ClN2O4- — CID 53314590
1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(4-methoxy-2-prop-2-enylphenoxy)propan-2-ol chloride (PubChem CID 53314590) has the molecular formula C24H32ClN2O4- and a molecular weight of 447.98 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(4-methoxy-2-prop-2-enylphenoxy)propan-2-ol chloride.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(4-methoxy-2-prop-2-enylphenoxy)propan-2-ol chloride |
|---|---|
| PubChem CID | 53314590 |
| Molecular Formula | C24H32ClN2O4- |
| Molecular Weight | 447.98 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(4-methoxy-2-prop-2-enylphenoxy)propan-2-ol chloride |
| SMILES | C=CCc1cc(OC)ccc1OCC(O)CN1CCN(c2ccc(OC)cc2)CC1.[Cl-] |
| InChI | InChI=1S/C24H32N2O4.ClH/c1-4-5-19-16-23(29-3)10-11-24(19)30-18-21(27)17-25-12-14-26(15-13-25)20-6-8-22(28-2)9-7-20;/h4,6-11,16,21,27H,1,5,12-15,17-18H2,2-3H3;1H/p-1 |
| InChIKey | JRHFTLXUALPRNZ-UHFFFAOYSA-M |
| XLogP | -0.00 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.98 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|