C20H25BrN2O3 — CID 34066311
(2R)-1-(2-bromophenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol (PubChem CID 34066311) has the molecular formula C20H25BrN2O3 and a molecular weight of 421.34 g/mol. Its IUPAC name is (2R)-1-(2-bromophenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(2-bromophenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 34066311 |
| Molecular Formula | C20H25BrN2O3 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (2R)-1-(2-bromophenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol |
| SMILES | COc1ccc(N2CCN(C[C@@H](O)COc3ccccc3Br)CC2)cc1 |
| InChI | InChI=1S/C20H25BrN2O3/c1-25-18-8-6-16(7-9-18)23-12-10-22(11-13-23)14-17(24)15-26-20-5-3-2-4-19(20)21/h2-9,17,24H,10-15H2,1H3/t17-/m1/s1 |
| InChIKey | ANHLVIDTQKYXNV-QGZVFWFLSA-N |
| XLogP | 3.02 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|