C22H30N2O5 — CID 1080818
(2R)-1-(2,6-dimethoxyphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol (PubChem CID 1080818) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is (2R)-1-(2,6-dimethoxyphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(2,6-dimethoxyphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 1080818 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (2R)-1-(2,6-dimethoxyphenoxy)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propan-2-ol |
| SMILES | COc1ccc(N2CCN(C[C@@H](O)COc3c(OC)cccc3OC)CC2)cc1 |
| InChI | InChI=1S/C22H30N2O5/c1-26-19-9-7-17(8-10-19)24-13-11-23(12-14-24)15-18(25)16-29-22-20(27-2)5-4-6-21(22)28-3/h4-10,18,25H,11-16H2,1-3H3/t18-/m1/s1 |
| InChIKey | BYQQSSSIBFCTJP-GOSISDBHSA-N |
| XLogP | 2.27 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|