C25H34N2O4 — CID 55832405
1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propan-2-ol (PubChem CID 55832405) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propan-2-ol.
| Compound Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 55832405 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propan-2-ol |
| SMILES | C/C=C/c1ccc(OCC(O)CN2CCCN(c3ccc(OC)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C25H34N2O4/c1-4-6-20-7-12-24(25(17-20)30-3)31-19-22(28)18-26-13-5-14-27(16-15-26)21-8-10-23(29-2)11-9-21/h4,6-12,17,22,28H,5,13-16,18-19H2,1-3H3/b6-4+ |
| InChIKey | AAVBJGRKFOVMSW-GQCTYLIASA-N |
| XLogP | 3.69 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|