C14H21ClN2O2 — CID 95067055
(2S)-1-(4-chlorophenoxy)-3-(1,4-diazepan-1-yl)propan-2-ol (PubChem CID 95067055) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenoxy)-3-(1,4-diazepan-1-yl)propan-2-ol.
| Compound Name | (2S)-1-(4-chlorophenoxy)-3-(1,4-diazepan-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 95067055 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (2S)-1-(4-chlorophenoxy)-3-(1,4-diazepan-1-yl)propan-2-ol |
| SMILES | O[C@H](COc1ccc(Cl)cc1)CN1CCCNCC1 |
| InChI | InChI=1S/C14H21ClN2O2/c15-12-2-4-14(5-3-12)19-11-13(18)10-17-8-1-6-16-7-9-17/h2-5,13,16,18H,1,6-11H2/t13-/m0/s1 |
| InChIKey | MEIHIMTXWAKCST-ZDUSSCGKSA-N |
| XLogP | 1.38 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |