C18H27ClN2O2 — CID 110887687
1-(4-chlorophenoxy)-3-(4-cyclopentylpiperazin-1-yl)propan-2-ol (PubChem CID 110887687) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-(4-cyclopentylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-(4-chlorophenoxy)-3-(4-cyclopentylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 110887687 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-(4-cyclopentylpiperazin-1-yl)propan-2-ol |
| SMILES | OC(COc1ccc(Cl)cc1)CN1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C18H27ClN2O2/c19-15-5-7-18(8-6-15)23-14-17(22)13-20-9-11-21(12-10-20)16-3-1-2-4-16/h5-8,16-17,22H,1-4,9-14H2 |
| InChIKey | QGYHCROEMHLVHN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |