C21H34N2O2 — CID 110887797
1-(4-cyclopentylpiperazin-1-yl)-3-(2,3,6-trimethylphenoxy)propan-2-ol (PubChem CID 110887797) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-(4-cyclopentylpiperazin-1-yl)-3-(2,3,6-trimethylphenoxy)propan-2-ol.
| Compound Name | 1-(4-cyclopentylpiperazin-1-yl)-3-(2,3,6-trimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 110887797 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 1-(4-cyclopentylpiperazin-1-yl)-3-(2,3,6-trimethylphenoxy)propan-2-ol |
| SMILES | Cc1ccc(C)c(OCC(O)CN2CCN(C3CCCC3)CC2)c1C |
| InChI | InChI=1S/C21H34N2O2/c1-16-8-9-17(2)21(18(16)3)25-15-20(24)14-22-10-12-23(13-11-22)19-6-4-5-7-19/h8-9,19-20,24H,4-7,10-15H2,1-3H3 |
| InChIKey | GMFIVJWMZVSXJY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |