C17H25ClN2O3 — CID 49231615
N-[1-[3-(4-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]-N-methylacetamide (PubChem CID 49231615) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is N-[1-[3-(4-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]-N-methylacetamide.
| Compound Name | N-[1-[3-(4-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 49231615 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[1-[3-(4-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)C1CCN(CC(O)COc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H25ClN2O3/c1-13(21)19(2)15-7-9-20(10-8-15)11-16(22)12-23-17-5-3-14(18)4-6-17/h3-6,15-16,22H,7-12H2,1-2H3 |
| InChIKey | ZJSTWJNAASBZDM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |