C20H24ClNO3 — CID 21396143
1-[3-[4-(4-chlorophenyl)phenoxy]-2-hydroxypropyl]piperidin-3-ol (PubChem CID 21396143) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is 1-[3-[4-(4-chlorophenyl)phenoxy]-2-hydroxypropyl]piperidin-3-ol.
| Compound Name | 1-[3-[4-(4-chlorophenyl)phenoxy]-2-hydroxypropyl]piperidin-3-ol |
|---|---|
| PubChem CID | 21396143 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-[3-[4-(4-chlorophenyl)phenoxy]-2-hydroxypropyl]piperidin-3-ol |
| SMILES | OC1CCCN(CC(O)COc2ccc(-c3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C20H24ClNO3/c21-17-7-3-15(4-8-17)16-5-9-20(10-6-16)25-14-19(24)13-22-11-1-2-18(23)12-22/h3-10,18-19,23-24H,1-2,11-14H2 |
| InChIKey | BZGNCHPTQMSBHC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |