C21H27ClN2O3 — CID 142125033
1-[3-[(4-aminophenoxy)methyl]piperidin-1-yl]-3-(4-chlorophenoxy)propan-2-ol (PubChem CID 142125033) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is 1-[3-[(4-aminophenoxy)methyl]piperidin-1-yl]-3-(4-chlorophenoxy)propan-2-ol.
| Compound Name | 1-[3-[(4-aminophenoxy)methyl]piperidin-1-yl]-3-(4-chlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 142125033 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[3-[(4-aminophenoxy)methyl]piperidin-1-yl]-3-(4-chlorophenoxy)propan-2-ol |
| SMILES | Nc1ccc(OCC2CCCN(CC(O)COc3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C21H27ClN2O3/c22-17-3-7-20(8-4-17)27-15-19(25)13-24-11-1-2-16(12-24)14-26-21-9-5-18(23)6-10-21/h3-10,16,19,25H,1-2,11-15,23H2 |
| InChIKey | QSXBRFIIWMKYPF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|