C24H31NO4 — CID 86973070
1-[4-[2-hydroxy-3-[3-(phenoxymethyl)piperidin-1-yl]propoxy]phenyl]propan-1-one (PubChem CID 86973070) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-[4-[2-hydroxy-3-[3-(phenoxymethyl)piperidin-1-yl]propoxy]phenyl]propan-1-one.
| Compound Name | 1-[4-[2-hydroxy-3-[3-(phenoxymethyl)piperidin-1-yl]propoxy]phenyl]propan-1-one |
|---|---|
| PubChem CID | 86973070 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 1-[4-[2-hydroxy-3-[3-(phenoxymethyl)piperidin-1-yl]propoxy]phenyl]propan-1-one |
| SMILES | CCC(=O)c1ccc(OCC(O)CN2CCCC(COc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H31NO4/c1-2-24(27)20-10-12-23(13-11-20)29-18-21(26)16-25-14-6-7-19(15-25)17-28-22-8-4-3-5-9-22/h3-5,8-13,19,21,26H,2,6-7,14-18H2,1H3 |
| InChIKey | QLWFTZICIKMVIO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |