C21H24F2N2O4 — CID 10136007
N-[4-fluoro-2-[3-[3-(4-fluorophenoxy)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide (PubChem CID 10136007) has the molecular formula C21H24F2N2O4 and a molecular weight of 406.43 g/mol. Its IUPAC name is N-[4-fluoro-2-[3-[3-(4-fluorophenoxy)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide.
| Compound Name | N-[4-fluoro-2-[3-[3-(4-fluorophenoxy)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 10136007 |
| Molecular Formula | C21H24F2N2O4 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[4-fluoro-2-[3-[3-(4-fluorophenoxy)pyrrolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)cc1OCC(O)CN1CCC(Oc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H24F2N2O4/c1-14(26)24-20-7-4-16(23)10-21(20)28-13-17(27)11-25-9-8-19(12-25)29-18-5-2-15(22)3-6-18/h2-7,10,17,19,27H,8-9,11-13H2,1H3,(H,24,26) |
| InChIKey | ABBYBQMCWKEBOY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |