C22H26FNO5 — CID 10135790
methyl 2-[3-[4-(4-fluorophenoxy)piperidin-1-yl]-2-hydroxypropoxy]benzoate (PubChem CID 10135790) has the molecular formula C22H26FNO5 and a molecular weight of 403.45 g/mol. Its IUPAC name is methyl 2-[3-[4-(4-fluorophenoxy)piperidin-1-yl]-2-hydroxypropoxy]benzoate.
| Compound Name | methyl 2-[3-[4-(4-fluorophenoxy)piperidin-1-yl]-2-hydroxypropoxy]benzoate |
|---|---|
| PubChem CID | 10135790 |
| Molecular Formula | C22H26FNO5 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | methyl 2-[3-[4-(4-fluorophenoxy)piperidin-1-yl]-2-hydroxypropoxy]benzoate |
| SMILES | COC(=O)c1ccccc1OCC(O)CN1CCC(Oc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H26FNO5/c1-27-22(26)20-4-2-3-5-21(20)28-15-17(25)14-24-12-10-19(11-13-24)29-18-8-6-16(23)7-9-18/h2-9,17,19,25H,10-15H2,1H3 |
| InChIKey | NBHJVKZDVXNVEZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |