C24H30FNO5 — CID 10296402
methyl 3-[2-[3-[4-(4-fluorophenoxy)piperidin-1-yl]-2-hydroxypropoxy]phenyl]propanoate (PubChem CID 10296402) has the molecular formula C24H30FNO5 and a molecular weight of 431.50 g/mol. Its IUPAC name is methyl 3-[2-[3-[4-(4-fluorophenoxy)piperidin-1-yl]-2-hydroxypropoxy]phenyl]propanoate.
| Compound Name | methyl 3-[2-[3-[4-(4-fluorophenoxy)piperidin-1-yl]-2-hydroxypropoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 10296402 |
| Molecular Formula | C24H30FNO5 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | methyl 3-[2-[3-[4-(4-fluorophenoxy)piperidin-1-yl]-2-hydroxypropoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccccc1OCC(O)CN1CCC(Oc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H30FNO5/c1-29-24(28)11-6-18-4-2-3-5-23(18)30-17-20(27)16-26-14-12-22(13-15-26)31-21-9-7-19(25)8-10-21/h2-5,7-10,20,22,27H,6,11-17H2,1H3 |
| InChIKey | YZVNDBXUNUQOLW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |