C15H15ClF4N2O4 — CID 138688696
[(2S)-2-(4-aminopiperidin-1-yl)-2-(4-chloro-3-fluorophenoxy)acetyl] 2,2,2-trifluoroacetate (PubChem CID 138688696) has the molecular formula C15H15ClF4N2O4 and a molecular weight of 398.74 g/mol. Its IUPAC name is [(2S)-2-(4-aminopiperidin-1-yl)-2-(4-chloro-3-fluorophenoxy)acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S)-2-(4-aminopiperidin-1-yl)-2-(4-chloro-3-fluorophenoxy)acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 138688696 |
| Molecular Formula | C15H15ClF4N2O4 |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | [(2S)-2-(4-aminopiperidin-1-yl)-2-(4-chloro-3-fluorophenoxy)acetyl] 2,2,2-trifluoroacetate |
| SMILES | NC1CCN([C@@H](Oc2ccc(Cl)c(F)c2)C(=O)OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H15ClF4N2O4/c16-10-2-1-9(7-11(10)17)25-12(22-5-3-8(21)4-6-22)13(23)26-14(24)15(18,19)20/h1-2,7-8,12H,3-6,21H2/t12-/m0/s1 |
| InChIKey | RCSXGXZAWBQNSJ-LBPRGKRZSA-N |
| XLogP | 2.24 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|