C15H14ClF3N2O4 — CID 153325860
[(3-amino-1-bicyclo[1.1.1]pentanyl)-[2-(4-chlorophenoxy)acetyl]amino] 2,2,2-trifluoroacetate (PubChem CID 153325860) has the molecular formula C15H14ClF3N2O4 and a molecular weight of 378.73 g/mol. Its IUPAC name is [(3-amino-1-bicyclo[1.1.1]pentanyl)-[2-(4-chlorophenoxy)acetyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [(3-amino-1-bicyclo[1.1.1]pentanyl)-[2-(4-chlorophenoxy)acetyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 153325860 |
| Molecular Formula | C15H14ClF3N2O4 |
| Molecular Weight | 378.73 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | [(3-amino-1-bicyclo[1.1.1]pentanyl)-[2-(4-chlorophenoxy)acetyl]amino] 2,2,2-trifluoroacetate |
| SMILES | NC12CC(N(OC(=O)C(F)(F)F)C(=O)COc3ccc(Cl)cc3)(C1)C2 |
| InChI | InChI=1S/C15H14ClF3N2O4/c16-9-1-3-10(4-2-9)24-5-11(22)21(25-12(23)15(17,18)19)14-6-13(20,7-14)8-14/h1-4H,5-8,20H2 |
| InChIKey | NQPUUSULIFWMIX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.73 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|